![Page 1: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/1.jpg)
Polyatomic IonsPolyatomic Ions
![Page 2: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/2.jpg)
Many ionic compounds are not binary Many ionic compounds are not binary because one or both ions contain because one or both ions contain atoms of more than one element. atoms of more than one element.
These These polyatomic ions consist of two polyatomic ions consist of two or more different non-metal atoms, or more different non-metal atoms,
which are joined by covalent bondswhich are joined by covalent bonds. . There is only one common There is only one common
polyatomic cation: the ammonium polyatomic cation: the ammonium ion, NHion, NH44
++.. There are many There are many polyatomic anions. polyatomic anions. Except for the Except for the
hydroxide ion, the names of thehydroxide ion, the names of the
![Page 3: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/3.jpg)
anions end inanions end in““-ate-ate””
instead of “ide”.instead of “ide”. Writing formulas is Writing formulas is also the same, except that you have to also the same, except that you have to
add parentheses when the formula add parentheses when the formula requires more than one polyatomic requires more than one polyatomic
ionion..Common polyatomic ions.Common polyatomic ions.
![Page 4: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/4.jpg)
Name (ion)Name (ion) Chemical FormulaChemical Formula
ammoniumammoniumhydroxidehydroxidecarbonatecarbonate
nitratenitratesulfatesulfate
hydrogen carbonatehydrogen carbonatehydrogen sulfatehydrogen sulfate
phosphate phosphate
![Page 5: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/5.jpg)
Name (ion)Name (ion) Chemical FormulaChemical Formula
ammoniumammonium NHNH44++
hydroxidehydroxidecarbonatecarbonate
nitratenitratesulfatesulfate
hydrogen carbonatehydrogen carbonatehydrogen sulfatehydrogen sulfate
phosphate phosphate
![Page 6: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/6.jpg)
Name (ion)Name (ion) Chemical FormulaChemical Formula
ammoniumammonium NHNH44++
hydroxidehydroxide OHOH--
carbonatecarbonatenitratenitratesulfatesulfate
hydrogen carbonatehydrogen carbonatehydrogen sulfatehydrogen sulfate
phosphate phosphate
![Page 7: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/7.jpg)
Name (ion)Name (ion) Chemical FormulaChemical Formula
ammoniumammonium NHNH44++
hydroxidehydroxide OHOH--
carbonatecarbonate COCO332-2-
nitratenitratesulfatesulfate
hydrogen carbonatehydrogen carbonatehydrogen sulfatehydrogen sulfate
phosphate phosphate
![Page 8: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/8.jpg)
Name (ion)Name (ion) Chemical FormulaChemical Formula
ammoniumammonium NHNH44++
hydroxidehydroxide OHOH--
carbonatecarbonate COCO332-2-
nitratenitrate NONO33--
sulfatesulfatehydrogen carbonatehydrogen carbonate
hydrogen sulfatehydrogen sulfatephosphate phosphate
![Page 9: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/9.jpg)
Name (ion)Name (ion) Chemical FormulaChemical Formula
ammoniumammonium NHNH44++
hydroxidehydroxide OHOH--
carbonatecarbonate COCO332-2-
nitratenitrate NONO33--
sulfatesulfate SOSO442-2-
hydrogen carbonatehydrogen carbonatehydrogen sulfatehydrogen sulfate
phosphate phosphate
![Page 10: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/10.jpg)
Name (ion)Name (ion) Chemical FormulaChemical Formula
ammoniumammonium NHNH44++
hydroxidehydroxide OHOH--
carbonatecarbonate COCO332-2-
nitratenitrate NONO33--
sulfatesulfate SOSO442-2-
hydrogen carbonatehydrogen carbonate HCOHCO33--
hydrogen sulfatehydrogen sulfatephosphate phosphate
![Page 11: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/11.jpg)
Name (ion)Name (ion) Chemical FormulaChemical Formula
ammoniumammonium NHNH44++
hydroxidehydroxide OHOH--
carbonatecarbonate COCO332-2-
nitratenitrate NONO33--
sulfatesulfate SOSO442-2-
hydrogen carbonatehydrogen carbonate HCOHCO33--
hydrogen sulfatehydrogen sulfate HSOHSO44--
phosphate phosphate
![Page 12: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/12.jpg)
Name (ion)Name (ion) Chemical FormulaChemical Formulaammoniumammonium NHNH44
++
hydroxidehydroxide OHOH--
carbonatecarbonate COCO332-2-
nitratenitrate NONO33--
sulfatesulfate SOSO442-2-
hydrogen carbonatehydrogen carbonate HCOHCO33--
hydrogen sulfatehydrogen sulfate HSOHSO44--
phosphate phosphate POPO443-3-
![Page 13: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/13.jpg)
Write the formulas of the following:
ammonium ammonium sulfidesulfide
CuCOCuCO33
![Page 14: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/14.jpg)
Write the formulas of the following:
ammonium ammonium sulfidesulfide
NHNH44+ + SS2-2-
CuCOCuCO33
![Page 15: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/15.jpg)
Write the formulas of the following:
ammonium ammonium sulfidesulfide
NHNH44+ + SS2-2- (NH(NH44))22SS
CuCOCuCO33
![Page 16: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/16.jpg)
Write the formulas of the following:
ammonium ammonium sulfidesulfide
NHNH44+ + SS2-2- (NH(NH44))22SS
CuCu2+ 2+ COCO2-2- CuCOCuCO33
![Page 17: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/17.jpg)
Write the formulas of the following:
ammonium ammonium sulfidesulfide
NHNH44+ + SS2-2- (NH(NH44))22SS
copper(II) copper(II) carbonatecarbonate
CuCu2+ 2+ COCO332-2- CuCOCuCO33
![Page 18: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/18.jpg)
Write the formulas of the following:
ammonium ammonium sulfidesulfide
NHNH44+ + SS2-2- (NH(NH44))22SS
copper(II) copper(II) carbonatecarbonate
oror
CuCu2+ 2+ COCO2-2- CuCOCuCO33
![Page 19: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/19.jpg)
Write the formulas of the following:
ammonium ammonium sulfidesulfide
NHNH44+ + SS2-2- (NH(NH44))22SS
copper(II) copper(II) carbonatecarbonate
ororcupric cupric
carbonatecarbonate
CuCu2+ 2+ COCO2-2- CuCOCuCO33
![Page 20: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/20.jpg)
Binary Molecular CompoundsBinary Molecular Compounds
Binary molecular compounds consist of Binary molecular compounds consist of covalent bonds between atoms of covalent bonds between atoms of
two different non-metals.two different non-metals.1.1. The name of a binary molecular The name of a binary molecular compound ends in “ide”, just like the compound ends in “ide”, just like the
came of a binary ionic compound.came of a binary ionic compound.2.2. The name and the formula usually The name and the formula usually
![Page 21: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/21.jpg)
begin with the element that is more to begin with the element that is more to the the left left on the periodic table.on the periodic table.
3. In the name, use a prefix to specify 3. In the name, use a prefix to specify the number of atoms of each element the number of atoms of each element that are present in a molecule. Some that are present in a molecule. Some
prefixes, and the numbers they prefixes, and the numbers they represent, are in the table below.represent, are in the table below.
![Page 22: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/22.jpg)
Number it Number it representsrepresents
PrefixPrefix
11
22
33
44
55
66
![Page 23: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/23.jpg)
Number it Number it representsrepresents
PrefixPrefix
11 monomono
22
33
44
55
66
![Page 24: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/24.jpg)
Number it Number it representsrepresents
PrefixPrefix
11 monomono
22 didi
33
44
55
66
![Page 25: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/25.jpg)
Number it Number it representsrepresents
PrefixPrefix
11 monomono
22 didi
33 tritri
44
55
66
![Page 26: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/26.jpg)
Number it Number it representsrepresents
PrefixPrefix
11 monomono
22 didi
33 tritri
44 tetratetra
55
66
![Page 27: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/27.jpg)
Number it Number it representsrepresents
PrefixPrefix
11 monomono
22 didi
33 tritri
44 tetratetra
55 pentapenta
66
![Page 28: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/28.jpg)
Number it Number it representsrepresents
PrefixPrefix
11 monomono
22 didi
33 tritri
44 tetratetra
55 pentapenta
66 hexahexa
![Page 29: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/29.jpg)
Naming the Oxides of NitrogenNaming the Oxides of Nitrogen
![Page 30: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/30.jpg)
FormulaFormula Systematic Systematic NameName
Common NameCommon Name
NONO
NN22OO
NONO22
NN22OO33
NN22OO44
NN22OO55
![Page 31: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/31.jpg)
FormulaFormula Systematic Systematic NameName
Common NameCommon Name
NONO nitrogen monoxidenitrogen monoxide
NN22OO
NONO22
NN22OO33
NN22OO44
NN22OO55
![Page 32: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/32.jpg)
FormulaFormula Systematic Systematic NameName
Common NameCommon Name
NONO nitrogen monoxidenitrogen monoxide nitric oxidenitric oxide
NN22OO
NONO22
NN22OO33
NN22OO44
NN22OO55
![Page 33: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/33.jpg)
FormulaFormula Systematic Systematic NameName
Common NameCommon Name
NONO nitrogen monoxidenitrogen monoxide nitric oxidenitric oxide
NN22OO dinitrogen dinitrogen monoxidemonoxide
NONO22
NN22OO33
NN22OO44
NN22OO55
![Page 34: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/34.jpg)
FormulaFormula Systematic Systematic NameName
Common NameCommon Name
NONO nitrogen monoxidenitrogen monoxide nitric oxidenitric oxide
NN22OO dinitrogen dinitrogen monoxidemonoxide
nitrous oxidenitrous oxide
NONO22
NN22OO33
NN22OO44
NN22OO55
![Page 35: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/35.jpg)
FormulaFormula Systematic Systematic NameName
Common NameCommon Name
NONO nitrogen monoxidenitrogen monoxide nitric oxidenitric oxide
NN22OO dinitrogen dinitrogen monoxidemonoxide
nitrous oxidenitrous oxide
NONO22nitrogen dioxidenitrogen dioxide
NN22OO33
NN22OO44
NN22OO55
![Page 36: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/36.jpg)
FormulaFormula Systematic Systematic NameName
Common NameCommon Name
NONO nitrogen monoxidenitrogen monoxide nitric oxidenitric oxide
NN22OO dinitrogen dinitrogen monoxidemonoxide
nitrous oxidenitrous oxide
NONO22nitrogen dioxidenitrogen dioxide nonenone
NN22OO33
NN22OO44
NN22OO55
![Page 37: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/37.jpg)
FormulaFormula Systematic Systematic NameName
Common NameCommon Name
NONO nitrogen monoxidenitrogen monoxide nitric oxidenitric oxide
NN22OO dinitrogen dinitrogen monoxidemonoxide
nitrous oxidenitrous oxide
NONO22nitrogen dioxidenitrogen dioxide nonenone
NN22OO33dinitrogen trioxidedinitrogen trioxide
NN22OO44
NN22OO55
![Page 38: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/38.jpg)
FormulaFormula Systematic Systematic NameName
Common NameCommon Name
NONO nitrogen monoxidenitrogen monoxide nitric oxidenitric oxide
NN22OO dinitrogen dinitrogen monoxidemonoxide
nitrous oxidenitrous oxide
NONO22nitrogen dioxidenitrogen dioxide nonenone
NN22OO33dinitrogen trioxidedinitrogen trioxide nonenone
NN22OO44
NN22OO55
![Page 39: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/39.jpg)
FormulaFormula Systematic Systematic NameName
Common NameCommon Name
NONO nitrogen monoxidenitrogen monoxide nitric oxidenitric oxide
NN22OO dinitrogen dinitrogen monoxidemonoxide
nitrous oxidenitrous oxide
NONO22nitrogen dioxidenitrogen dioxide nonenone
NN22OO33dinitrogen trioxidedinitrogen trioxide nonenone
NN22OO44dinitrogen tetroxidedinitrogen tetroxide
NN22OO55
![Page 40: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/40.jpg)
FormulaFormula Systematic Systematic NameName
Common NameCommon Name
NONO nitrogen monoxidenitrogen monoxide nitric oxidenitric oxide
NN22OO dinitrogen dinitrogen monoxidemonoxide
nitrous oxidenitrous oxide
NONO22nitrogen dioxidenitrogen dioxide nonenone
NN22OO33dinitrogen trioxidedinitrogen trioxide nonenone
NN22OO44dinitrogen tetroxidedinitrogen tetroxide nonenone
NN22OO55
![Page 41: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/41.jpg)
FormulaFormula Systematic Systematic NameName
Common NameCommon Name
NONO nitrogen monoxidenitrogen monoxide nitric oxidenitric oxide
NN22OO dinitrogen dinitrogen monoxidemonoxide
nitrous oxidenitrous oxide
NONO22nitrogen dioxidenitrogen dioxide nonenone
NN22OO33dinitrogen trioxidedinitrogen trioxide nonenone
NN22OO44dinitrogen tetroxidedinitrogen tetroxide nonenone
NN22OO55dinitrogen dinitrogen pentoxidepentoxide
![Page 42: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/42.jpg)
FormulaFormula Systematic Systematic NameName
Common NameCommon Name
NONO nitrogen monoxidenitrogen monoxide nitric oxidenitric oxide
NN22OO dinitrogen dinitrogen monoxidemonoxide
nitrous oxidenitrous oxide
NONO22nitrogen dioxidenitrogen dioxide nonenone
NN22OO33dinitrogen trioxidedinitrogen trioxide nonenone
NN22OO44dinitrogen tetroxidedinitrogen tetroxide nonenone
NN22OO55dinitrogen dinitrogen pentoxidepentoxide
nonenone
![Page 43: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/43.jpg)
Write the correct name for each of the Write the correct name for each of the following.following.
![Page 44: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/44.jpg)
BaClBaCl22
LiBrLiBr
NaNa22SS
RbRb22OO
GaFGaF33
![Page 45: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/45.jpg)
BaClBaCl22 barium chloridebarium chloride
LiBrLiBr
NaNa22SS
RbRb22OO
GaFGaF33
![Page 46: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/46.jpg)
BaClBaCl22 barium chloridebarium chloride
LiBrLiBr lithium bromidelithium bromide
NaNa22SS
RbRb22OO
GaFGaF33
![Page 47: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/47.jpg)
BaClBaCl22 barium chloridebarium chloride
LiBrLiBr lithium bromidelithium bromide
NaNa22SS sodium sulfidesodium sulfide
RbRb22OO
GaFGaF33
![Page 48: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/48.jpg)
BaClBaCl22 barium chloridebarium chloride
LiBrLiBr lithium bromidelithium bromide
NaNa22SS sodium sulfidesodium sulfide
RbRb22OO rubidium oxiderubidium oxide
GaFGaF33
![Page 49: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/49.jpg)
BaClBaCl22 barium chloridebarium chloride
LiBrLiBr lithium bromidelithium bromide
NaNa22SS sodium sulfidesodium sulfide
RbRb22OO rubidium oxiderubidium oxide
GaFGaF33 gallium fluoridegallium fluoride
![Page 50: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/50.jpg)
AlAl33SS22
AgIAgI
MgSMgS
SOSO22
NaBrNaBr
![Page 51: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/51.jpg)
AlAl33SS22 aluminum sulfidealuminum sulfide
AgIAgI
MgSMgS
SOSO22
NaBrNaBr
![Page 52: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/52.jpg)
AlAl33SS22 aluminum sulfidealuminum sulfide
AgIAgI silver(I) iodidesilver(I) iodide
MgSMgS
SOSO22
NaBrNaBr
![Page 53: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/53.jpg)
AlAl33SS22 aluminum sulfidealuminum sulfide
AgIAgI silver(I) iodidesilver(I) iodide
MgSMgS magnesium sulfidemagnesium sulfide
SOSO22
NaBrNaBr
![Page 54: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/54.jpg)
AlAl33SS22 aluminum sulfidealuminum sulfide
AgIAgI silver(I) iodidesilver(I) iodide
MgSMgS magnesium sulfidemagnesium sulfide
SOSO22 sulfur dioxidesulfur dioxide
NaBrNaBr
![Page 55: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/55.jpg)
AlAl33SS22 aluminum sulfidealuminum sulfide
AgIAgI silver(I) iodidesilver(I) iodide
MgSMgS magnesium sulfidemagnesium sulfide
SOSO22 sulfur dioxidesulfur dioxide
NaBrNaBr sodium bromidesodium bromide
![Page 56: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/56.jpg)
Sn(SOSn(SO44))22
CuCu22SS
NaOHNaOH
CuSOCuSO44
![Page 57: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/57.jpg)
Sn(SOSn(SO44))22SnSn2+2+ (SO (SO44))22
--
CuCu22SS
NaOHNaOH
CuSOCuSO44
![Page 58: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/58.jpg)
Sn(SOSn(SO44))22SnSn2+2+(SO(SO44))22
- - SnSn4+4+(SO(SO44))222- 2-
CuCu22SS
NaOHNaOH
CuSOCuSO44
![Page 59: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/59.jpg)
Sn(SOSn(SO44))22SnSn2+2+(SO(SO44))22
- - SnSn4+4+(SO(SO44))222- 2-
tin(IV) sulfatetin(IV) sulfate
CuCu22SS
NaOHNaOH
CuSOCuSO44
![Page 60: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/60.jpg)
Sn(SOSn(SO44))22SnSn2+2+(SO(SO44))22
- - SnSn4+4+(SO(SO44))222- 2-
tin(IV) sulfatetin(IV) sulfate
CuCu22SS CuCu22++
SS2-2-
NaOHNaOH
CuSOCuSO44
![Page 61: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/61.jpg)
Sn(SOSn(SO44))22SnSn2+2+(SO(SO44))22
- - SnSn4+4+(SO(SO44))222- 2-
tin(IV) sulfatetin(IV) sulfate
CuCu22SS CuCu22++
SS2-2-
copper(1) sulfidecopper(1) sulfide
NaOHNaOH
CuSOCuSO44
![Page 62: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/62.jpg)
Sn(SOSn(SO44))22SnSn2+2+(SO(SO44))22
- - SnSn4+4+(SO(SO44))222- 2-
tin(IV) sulfatetin(IV) sulfate
CuCu22SS CuCu22++
SS2-2-
copper(1) sulfidecopper(1) sulfideor cuprous sulfideor cuprous sulfide
NaOHNaOH
CuSOCuSO44
![Page 63: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/63.jpg)
Sn(SOSn(SO44))22SnSn2+2+(SO(SO44))22
- - SnSn4+4+(SO(SO44))222- 2-
tin(IV) sulfatetin(IV) sulfate
CuCu22SS CuCu22++
SS2-2-
copper(1) sulfidecopper(1) sulfideor cuprous sulfideor cuprous sulfide
NaOHNaOH sodium sodium hydroxidehydroxide
CuSOCuSO44
![Page 64: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/64.jpg)
Sn(SOSn(SO44))22SnSn2+2+(SO(SO44))22
- - SnSn4+4+(SO(SO44))222- 2-
tin(IV) sulfatetin(IV) sulfate
CuCu22SS CuCu22++
SS2-2-
copper(1) sulfidecopper(1) sulfideor cuprous sulfideor cuprous sulfide
NaOHNaOH sodium sodium hydroxidehydroxide
CuSOCuSO44CuCu++ SO SO44
--
![Page 65: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/65.jpg)
Sn(SOSn(SO44))22SnSn2+2+(SO(SO44))22
- - SnSn4+4+(SO(SO44))222- 2-
tin(IV) sulfatetin(IV) sulfate
CuCu22SS CuCu22++
SS2-2-
copper(1) sulfidecopper(1) sulfideor cuprous sulfideor cuprous sulfide
NaOHNaOH sodium sodium hydroxidehydroxide
CuSOCuSO44CuCu++ SO SO44
-- CuCu2+2+ SO SO442-2-
![Page 66: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/66.jpg)
Sn(SOSn(SO44))22SnSn2+2+(SO(SO44))22
- - SnSn4+4+(SO(SO44))222- 2-
tin(IV) sulfatetin(IV) sulfate
CuCu22SS CuCu22++
SS2-2-
copper(1) sulfidecopper(1) sulfideor cuprous sulfideor cuprous sulfide
NaOHNaOH sodium sodium hydroxidehydroxide
CuSOCuSO44CuCu++ SO SO44
-- CuCu2+2+ SO SO442-2-
copper(II) sulfatecopper(II) sulfate
![Page 67: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/67.jpg)
Sn(SOSn(SO44))22SnSn2+2+(SO(SO44))22
- - SnSn4+4+(SO(SO44))222- 2-
tin(IV) sulfatetin(IV) sulfate
CuCu22SS CuCu22++
SS2-2-
copper(1) sulfidecopper(1) sulfideor cuprous sulfideor cuprous sulfide
NaOHNaOH sodium sodium hydroxidehydroxide
CuSOCuSO44CuCu++ SO SO44
-- CuCu2+2+ SO SO442-2-
copper(II) sulfatecopper(II) sulfate
or cupric sulfateor cupric sulfate
![Page 68: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/68.jpg)
Fe(NOFe(NO33))22
PClPCl55
CuCu22SOSO44
Pb(NOPb(NO33))22
![Page 69: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/69.jpg)
Fe(NOFe(NO33))22 FeFe2+ 2+ NONO331-1-
PClPCl55
CuCu22SOSO44
Pb(NOPb(NO33))22
![Page 70: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/70.jpg)
Fe(NOFe(NO33))22 FeFe2+ 2+ NONO331-1-
iron(II) nitrateiron(II) nitratePClPCl55
CuCu22SOSO44
Pb(NOPb(NO33))22
![Page 71: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/71.jpg)
Fe(NOFe(NO33))22 FeFe2+ 2+ NONO331-1-
iron(II) nitrateiron(II) nitratePClPCl55 phosphorus phosphorus
pentachloridepentachloride
CuCu22SOSO44
Pb(NOPb(NO33))22
![Page 72: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/72.jpg)
Fe(NOFe(NO33))22 FeFe2+ 2+ NONO331-1-
iron(II) nitrateiron(II) nitratePClPCl55 phosphorus phosphorus
pentachloridepentachloride
CuCu22SOSO44 CuCu1+ 1+ SOSO442-2-
Pb(NOPb(NO33))22
![Page 73: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/73.jpg)
Fe(NOFe(NO33))22 FeFe2+ 2+ NONO331-1-
iron(II) nitrateiron(II) nitratePClPCl55 phosphorus phosphorus
pentachloridepentachloride
CuCu22SOSO44 CuCu1+ 1+ SOSO442-2-
copper(I) sulfatecopper(I) sulfate
Pb(NOPb(NO33))22
![Page 74: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/74.jpg)
Fe(NOFe(NO33))22 FeFe2+ 2+ NONO331-1-
iron(II) nitrateiron(II) nitratePClPCl55 phosphorus phosphorus
pentachloridepentachloride
CuCu22SOSO44 CuCu1+ 1+ SOSO442-2-
copper(I) sulfatecopper(I) sulfate
Pb(NOPb(NO33))22 PbPb2+ 2+ NONO331-1-
![Page 75: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/75.jpg)
Fe(NOFe(NO33))22 FeFe2+ 2+ NONO331-1-
iron(II) nitrateiron(II) nitratePClPCl55 phosphorus phosphorus
pentachloridepentachlorideCuCu22SOSO44 CuCu1+ 1+ SOSO44
2-2-
copper(I) sulfatecopper(I) sulfatePb(NOPb(NO33))22 PbPb2+ 2+ NONO33
1-1-
lead(II) nitratelead(II) nitrate
![Page 76: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/76.jpg)
MoClMoCl55
NINI33
Mg(HSOMg(HSO44))22
NaNa33POPO44
![Page 77: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/77.jpg)
MoClMoCl55 MoMo5+ 5+ ClCl1-1-
NINI33
Mg(HSOMg(HSO44))22
NaNa33POPO44
![Page 78: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/78.jpg)
MoClMoCl55 MoMo5+ 5+ ClCl1-1-
molybdenum(V) molybdenum(V) chloridechloride
NINI33
Mg(HSOMg(HSO44))22
NaNa33POPO44
![Page 79: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/79.jpg)
MoClMoCl55 MoMo5+ 5+ ClCl1-1-
molybdenum(V) molybdenum(V) chloridechloride
NINI33 nitrogen nitrogen triodidetriodide
Mg(HSOMg(HSO44))22
NaNa33POPO44
![Page 80: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/80.jpg)
MoClMoCl55 MoMo5+ 5+ ClCl1-1-
molybdenum(V) molybdenum(V) chloridechloride
NINI33 nitrogen nitrogen triodidetriodide
Mg(HSOMg(HSO44))22 magnesium magnesium hydrogen sulfatehydrogen sulfate
NaNa33POPO44
![Page 81: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/81.jpg)
MoClMoCl55 MoMo5+ 5+ ClCl1-1-
molybdenum(V) molybdenum(V) chloridechloride
NINI33 nitrogen nitrogen triodidetriodide
Mg(HSOMg(HSO44))22 magnesium magnesium hydrogen sulfatehydrogen sulfate
NaNa33POPO44 sodium sodium phosphatephosphate
![Page 82: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/82.jpg)
Ca(HCOCa(HCO33))22
Pb(NOPb(NO33))22
(NH(NH44))22SS
Fe(OH)Fe(OH)33
![Page 83: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/83.jpg)
Ca(HCOCa(HCO33))22 calcium hydrogen calcium hydrogen carbonatecarbonate
Pb(NOPb(NO33))22
(NH(NH44))22SS
Fe(OH)Fe(OH)33
![Page 84: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/84.jpg)
Ca(HCOCa(HCO33))22 calcium hydrogen calcium hydrogen carbonatecarbonate
Pb(NOPb(NO33))22 PbPb2+ 2+ NONO331-1-
(NH(NH44))22SS
Fe(OH)Fe(OH)33
![Page 85: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/85.jpg)
Ca(HCOCa(HCO33))22 calcium hydrogen calcium hydrogen carbonatecarbonate
Pb(NOPb(NO33))22 PbPb2+ 2+ NONO331-1-
lead(II) nitratelead(II) nitrate(NH(NH44))22SS
Fe(OH)Fe(OH)33
![Page 86: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/86.jpg)
Ca(HCOCa(HCO33))22 calcium hydrogen calcium hydrogen carbonatecarbonate
Pb(NOPb(NO33))22 PbPb2+ 2+ NONO331-1-
lead(II) nitratelead(II) nitrate(NH(NH44))22SS ammonium ammonium
sulfidesulfide
Fe(OH)Fe(OH)33
![Page 87: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/87.jpg)
Ca(HCOCa(HCO33))22 calcium hydrogen calcium hydrogen carbonatecarbonate
Pb(NOPb(NO33))22 PbPb2+ 2+ NONO331-1-
lead(II) nitratelead(II) nitrate(NH(NH44))22SS ammonium ammonium
sulfidesulfide
Fe(OH)Fe(OH)33 FeFe3+ 3+ OHOH1-1-
![Page 88: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/88.jpg)
Ca(HCOCa(HCO33))22 calcium hydrogen calcium hydrogen carbonatecarbonate
Pb(NOPb(NO33))22 PbPb2+ 2+ NONO331-1-
lead(II) nitratelead(II) nitrate(NH(NH44))22SS ammonium ammonium
sulfidesulfide
Fe(OH)Fe(OH)33 FeFe3+ 3+ OHOH1-1-
iron(III) hydroxideiron(III) hydroxide
![Page 89: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/89.jpg)
NHNH44NONO33
![Page 90: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/90.jpg)
NHNH44NONO33 ammonium ammonium nitratenitrate
![Page 91: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/91.jpg)
Write the correct chemical Write the correct chemical formula for each of the formula for each of the
following.following.
![Page 92: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/92.jpg)
magnesium magnesium chloridechloride
sodium fluoridesodium fluoride
beryllium oxideberyllium oxide
calcium nitridecalcium nitride
![Page 93: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/93.jpg)
magnesium magnesium chloridechloride
MgMg2+ 2+ ClCl1-1-
sodium fluoridesodium fluoride
beryllium oxideberyllium oxide
calcium nitridecalcium nitride
![Page 94: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/94.jpg)
magnesium magnesium chloridechloride
MgMg2+ 2+ ClCl1-1-
MgClMgCl22
sodium fluoridesodium fluoride
beryllium oxideberyllium oxide
calcium nitridecalcium nitride
![Page 95: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/95.jpg)
magnesium magnesium chloridechloride
MgMg2+ 2+ ClCl1-1-
MgClMgCl22
sodium fluoridesodium fluoride NaNa1+ 1+ FF1-1-
beryllium oxideberyllium oxide
calcium nitridecalcium nitride
![Page 96: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/96.jpg)
magnesium magnesium chloridechloride
MgMg2+ 2+ ClCl1-1-
MgClMgCl22
sodium fluoridesodium fluoride NaNa1+ 1+ FF1-1-
NaFNaF
beryllium oxideberyllium oxide
calcium nitridecalcium nitride
![Page 97: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/97.jpg)
magnesium magnesium chloridechloride
MgMg2+ 2+ ClCl1-1-
MgClMgCl22
sodium fluoridesodium fluoride NaNa1+ 1+ FF1-1-
NaFNaF
beryllium oxideberyllium oxide BeBe2+ 2+ OO2- 2- BeBe22OO22
calcium nitridecalcium nitride
![Page 98: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/98.jpg)
magnesium magnesium chloridechloride
MgMg2+ 2+ ClCl1-1-
MgClMgCl22
sodium fluoridesodium fluoride NaNa1+ 1+ FF1-1-
NaFNaF
beryllium oxideberyllium oxide BeBe2+ 2+ OO2- 2- BeBe22OO22
BeOBeOcalcium nitridecalcium nitride
![Page 99: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/99.jpg)
magnesium magnesium chloridechloride
MgMg2+ 2+ ClCl1-1-
MgClMgCl22
sodium fluoridesodium fluoride NaNa1+ 1+ FF1-1-
NaFNaF
beryllium oxideberyllium oxide BeBe2+ 2+ OO2- 2- BeBe22OO22
BeOBeOcalcium nitridecalcium nitride CaCa2+ 2+ NN3-3-
![Page 100: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/100.jpg)
magnesium magnesium chloridechloride
MgMg2+ 2+ ClCl1-1-
MgClMgCl22
sodium fluoridesodium fluoride NaNa1+ 1+ FF1-1-
NaFNaF
beryllium oxideberyllium oxide BeBe2+ 2+ OO2- 2- BeBe22OO22
BeOBeOcalcium nitridecalcium nitride CaCa2+ 2+ NN3-3-
CaCa33NN22
![Page 101: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/101.jpg)
strontium strontium phosphidephosphide
aluminum sulfidealuminum sulfide
chromium(II) chromium(II) oxideoxide
silver(I) chloridesilver(I) chloride
![Page 102: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/102.jpg)
strontium strontium phosphidephosphide
SrSr2+ 2+ PP3-3-
aluminum sulfidealuminum sulfide
chromium(II) chromium(II) oxideoxide
silver(I) chloridesilver(I) chloride
![Page 103: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/103.jpg)
strontium strontium phosphidephosphide
SrSr2+ 2+ PP3-3-
SrSr33PP22
aluminum sulfidealuminum sulfide
chromium(II) chromium(II) oxideoxide
silver(I) chloridesilver(I) chloride
![Page 104: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/104.jpg)
strontium strontium phosphidephosphide
SrSr2+ 2+ PP3-3-
SrSr33PP22
aluminum sulfidealuminum sulfide AlAl3+ 3+ SS2-2-
chromium(II) chromium(II) oxideoxide
silver(I) chloridesilver(I) chloride
![Page 105: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/105.jpg)
strontium strontium phosphidephosphide
SrSr2+ 2+ PP3-3-
SrSr33PP22
aluminum sulfidealuminum sulfide AlAl3+ 3+ SS2-2-
AlAl22SS33
chromium(II) chromium(II) oxideoxide
silver(I) chloridesilver(I) chloride
![Page 106: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/106.jpg)
strontium strontium phosphidephosphide
SrSr2+ 2+ PP3-3-
SrSr33PP22
aluminum sulfidealuminum sulfide AlAl3+ 3+ SS2-2-
AlAl22SS33
chromium(II) chromium(II) oxideoxide
CrCr2+ 2+ OO2-2-
silver(I) chloridesilver(I) chloride
![Page 107: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/107.jpg)
strontium strontium phosphidephosphide
SrSr2+ 2+ PP3-3-
SrSr33PP22
aluminum sulfidealuminum sulfide AlAl3+ 3+ SS2-2-
AlAl22SS33
chromium(II) chromium(II) oxideoxide
CrCr2+ 2+ OO2-2-
CrOCrO
silver(I) chloridesilver(I) chloride
![Page 108: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/108.jpg)
strontium strontium phosphidephosphide
SrSr2+ 2+ PP3-3-
SrSr33PP22
aluminum sulfidealuminum sulfide AlAl3+ 3+ SS2-2-
AlAl22SS33
chromium(II) chromium(II) oxideoxide
CrCr2+ 2+ OO2-2-
CrOCrO
silver(I) chloridesilver(I) chloride AgAg1+ 1+ ClCl1-1-
![Page 109: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/109.jpg)
strontium strontium phosphidephosphide
SrSr2+ 2+ PP3-3-
SrSr33PP22
aluminum sulfidealuminum sulfide AlAl3+ 3+ SS2-2-
AlAl22SS33
chromium(II) chromium(II) oxideoxide
CrCr2+ 2+ OO2-2-
CrOCrO
silver(I) chloridesilver(I) chloride AgAg1+ 1+ ClCl1-1-
AgClAgCl
![Page 110: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/110.jpg)
zinc(II) sulphatezinc(II) sulphate
barium hydrogen barium hydrogen carbonatecarbonate
gold(III) nitrategold(III) nitrate
trinitrogen trinitrogen tetraoxidetetraoxide
![Page 111: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/111.jpg)
zinc(II) sulphatezinc(II) sulphate ZnZn2+ 2+ SOSO442-2-
barium hydrogen barium hydrogen carbonatecarbonate
gold(III) nitrategold(III) nitrate
trinitrogen trinitrogen tetraoxidetetraoxide
![Page 112: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/112.jpg)
zinc(II) sulphatezinc(II) sulphate ZnZn2+ 2+ SOSO442-2-
ZnSOZnSO44
barium hydrogen barium hydrogen carbonatecarbonate
gold(III) nitrategold(III) nitrate
trinitrogen trinitrogen tetraoxidetetraoxide
![Page 113: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/113.jpg)
zinc(II) sulphatezinc(II) sulphate ZnZn2+ 2+ SOSO442-2-
ZnSOZnSO44
barium hydrogen barium hydrogen carbonatecarbonate
BaBa2+ 2+ HCOHCO331-1-
gold(III) nitrategold(III) nitrate
trinitrogen trinitrogen tetraoxidetetraoxide
![Page 114: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/114.jpg)
zinc(II) sulphatezinc(II) sulphate ZnZn2+ 2+ SOSO442-2-
ZnSOZnSO44
barium hydrogen barium hydrogen carbonatecarbonate
BaBa2+ 2+ HCOHCO331-1-
Ba(Ba( HCOHCO33))22
gold(III) nitrategold(III) nitrate
trinitrogen trinitrogen tetraoxidetetraoxide
![Page 115: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/115.jpg)
zinc(II) sulphatezinc(II) sulphate ZnZn2+ 2+ SOSO442-2-
ZnSOZnSO44
barium hydrogen barium hydrogen carbonatecarbonate
BaBa2+ 2+ HCOHCO331-1-
Ba(Ba( HCOHCO33))22
gold(III) nitrategold(III) nitrate AuAu3+ 3+ NONO331-1-
trinitrogen trinitrogen tetraoxidetetraoxide
![Page 116: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/116.jpg)
zinc(II) sulphatezinc(II) sulphate ZnZn2+ 2+ SOSO442-2-
ZnSOZnSO44
barium hydrogen barium hydrogen carbonatecarbonate
BaBa2+ 2+ HCOHCO331-1-
Ba(Ba( HCOHCO33))22
gold(III) nitrategold(III) nitrate AuAu3+ 3+ NONO331-1-
Au(NOAu(NO33))33
trinitrogen trinitrogen tetraoxidetetraoxide
![Page 117: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/117.jpg)
zinc(II) sulphatezinc(II) sulphate ZnZn2+ 2+ SOSO442-2-
ZnSOZnSO44
barium hydrogen barium hydrogen carbonatecarbonate
BaBa2+ 2+ HCOHCO331-1-
Ba(Ba( HCOHCO33))22
gold(III) nitrategold(III) nitrate AuAu3+ 3+ NONO331-1-
Au(NOAu(NO33))33
trinitrogen trinitrogen tetraoxidetetraoxide
NN33OO44
![Page 118: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/118.jpg)
pentanitrogen pentanitrogen hexoxidehexoxide
cupric iodidecupric iodide
strontium fluoridestrontium fluoride
barium phosphatebarium phosphate
![Page 119: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/119.jpg)
pentanitrogen pentanitrogen hexoxidehexoxide
NN55OO66
cupric iodidecupric iodide
strontium fluoridestrontium fluoride
barium phosphatebarium phosphate
![Page 120: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/120.jpg)
pentanitrogen pentanitrogen hexoxidehexoxide
NN55OO66
cupric iodidecupric iodide CuCu2+2+ I I1-1-
strontium fluoridestrontium fluoride
barium phosphatebarium phosphate
![Page 121: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/121.jpg)
pentanitrogen pentanitrogen hexoxidehexoxide
NN55OO66
cupric iodidecupric iodide CuCu2+2+ I I1-1-
CuICuI22
strontium fluoridestrontium fluoride
barium phosphatebarium phosphate
![Page 122: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/122.jpg)
pentanitrogen pentanitrogen hexoxidehexoxide
NN55OO66
cupric iodidecupric iodide CuCu2+2+ I I1-1-
CuICuI22
strontium fluoridestrontium fluoride SrSr2+ 2+ FF1-1-
barium phosphatebarium phosphate
![Page 123: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/123.jpg)
pentanitrogen pentanitrogen hexoxidehexoxide
NN55OO66
cupric iodidecupric iodide CuCu2+2+ I I1-1-
CuICuI22
strontium fluoridestrontium fluoride SrSr2+ 2+ FF1-1-
SrFSrF22
barium phosphatebarium phosphate
![Page 124: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/124.jpg)
pentanitrogen pentanitrogen hexoxidehexoxide
NN55OO66
cupric iodidecupric iodide CuCu2+2+ I I1-1-
CuICuI22
strontium fluoridestrontium fluoride SrSr2+ 2+ FF1-1-
SrFSrF22
barium phosphatebarium phosphate BaBa2+ 2+ POPO443-3-
![Page 125: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/125.jpg)
pentanitrogen pentanitrogen hexoxidehexoxide
NN55OO66
cupric iodidecupric iodide CuCu2+2+ I I1-1-
CuICuI22
strontium fluoridestrontium fluoride SrSr2+ 2+ FF1-1-
SrFSrF22
barium phosphatebarium phosphate BaBa2+ 2+ POPO443-3-
BaBa33(PO(PO44))22
![Page 126: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/126.jpg)
sulfur trioxidesulfur trioxide
sodium oxidesodium oxide
carbon trioxidecarbon trioxide
aluminum sulphidealuminum sulphide
![Page 127: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/127.jpg)
sulfur trioxidesulfur trioxide SOSO33
sodium oxidesodium oxide
carbon trioxidecarbon trioxide
aluminum sulphidealuminum sulphide
![Page 128: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/128.jpg)
sulfur trioxidesulfur trioxide SOSO33
sodium oxidesodium oxide NaNa1+ 1+ OO2-2-
carbon trioxidecarbon trioxide
aluminum sulphidealuminum sulphide
![Page 129: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/129.jpg)
sulfur trioxidesulfur trioxide SOSO33
sodium oxidesodium oxide NaNa1+ 1+ OO2-2-
NaNa22OO
carbon trioxidecarbon trioxide
aluminum sulphidealuminum sulphide
![Page 130: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/130.jpg)
sulfur trioxidesulfur trioxide SOSO33
sodium oxidesodium oxide NaNa1+ 1+ OO2-2-
NaNa22OO
carbon trioxidecarbon trioxide COCO33
aluminum sulphidealuminum sulphide
![Page 131: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/131.jpg)
sulfur trioxidesulfur trioxide SOSO33
sodium oxidesodium oxide NaNa1+ 1+ OO2-2-
NaNa22OO
carbon trioxidecarbon trioxide COCO33
aluminum sulphidealuminum sulphide AlAl3+ 3+ SS2-2-
![Page 132: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/132.jpg)
sulfur trioxidesulfur trioxide SOSO33
sodium oxidesodium oxide NaNa1+ 1+ OO2-2-
NaNa22OO
carbon trioxidecarbon trioxide COCO33
aluminum sulphidealuminum sulphide AlAl3+ 3+ SS2-2-
AlAl22SS33
![Page 133: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/133.jpg)
calcium hydroxidecalcium hydroxide
aluminum aluminum carbonatecarbonate
iron(III) oxideiron(III) oxide
copper(I) sulfidecopper(I) sulfide
![Page 134: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/134.jpg)
calcium hydroxidecalcium hydroxide CaCa2+ 2+ OHOH1-1-
aluminum aluminum carbonatecarbonate
iron(III) oxideiron(III) oxide
copper(I) sulfidecopper(I) sulfide
![Page 135: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/135.jpg)
calcium hydroxidecalcium hydroxide CaCa2+ 2+ OHOH1-1-
Ca(OH)Ca(OH)22
aluminum aluminum carbonatecarbonate
iron(III) oxideiron(III) oxide
copper(I) sulfidecopper(I) sulfide
![Page 136: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/136.jpg)
calcium hydroxidecalcium hydroxide CaCa2+ 2+ OHOH1-1-
Ca(OH)Ca(OH)22
aluminum aluminum carbonatecarbonate
AlAl3+ 3+ COCO332-2-
iron(III) oxideiron(III) oxide
copper(I) sulfidecopper(I) sulfide
![Page 137: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/137.jpg)
calcium hydroxidecalcium hydroxide CaCa2+ 2+ OHOH1-1-
Ca(OH)Ca(OH)22
aluminum aluminum carbonatecarbonate
AlAl3+ 3+ COCO332-2-
AlAl22COCO33
iron(III) oxideiron(III) oxide
copper(I) sulfidecopper(I) sulfide
![Page 138: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/138.jpg)
calcium hydroxidecalcium hydroxide CaCa2+ 2+ OHOH1-1-
Ca(OH)Ca(OH)22
aluminum aluminum carbonatecarbonate
AlAl3+ 3+ COCO332-2-
AlAl22COCO33
iron(III) oxideiron(III) oxide FeFe3+ 3+ OO2-2-
copper(I) sulfidecopper(I) sulfide
![Page 139: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/139.jpg)
calcium hydroxidecalcium hydroxide CaCa2+ 2+ OHOH1-1-
Ca(OH)Ca(OH)22
aluminum aluminum carbonatecarbonate
AlAl3+ 3+ COCO332-2-
AlAl22COCO33
iron(III) oxideiron(III) oxide FeFe3+ 3+ OO2-2-
FeFe22OO33
copper(I) sulfidecopper(I) sulfide
![Page 140: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/140.jpg)
calcium hydroxidecalcium hydroxide CaCa2+ 2+ OHOH1-1-
Ca(OH)Ca(OH)22
aluminum aluminum carbonatecarbonate
AlAl3+ 3+ COCO332-2-
AlAl22COCO33
iron(III) oxideiron(III) oxide FeFe3+ 3+ OO2-2-
FeFe22OO33
copper(I) sulfidecopper(I) sulfide CuCu1+ 1+ SS2-2-
![Page 141: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/141.jpg)
calcium hydroxidecalcium hydroxide CaCa2+ 2+ OHOH1-1-
Ca(OH)Ca(OH)22
aluminum aluminum carbonatecarbonate
AlAl3+ 3+ COCO332-2-
AlAl22COCO33
iron(III) oxideiron(III) oxide FeFe3+ 3+ OO2-2-
FeFe22OO33
copper(I) sulfidecopper(I) sulfide CuCu1+ 1+ SS2-2-
CuCu22SS
![Page 142: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/142.jpg)
![Page 143: Polyatomic Ions. Many ionic compounds are not binary because one or both ions contain atoms of more than one element. These polyatomic ions consist of](https://reader035.vdocuments.us/reader035/viewer/2022062600/5a4d1bbf7f8b9ab0599d256a/html5/thumbnails/143.jpg)
The End